Details for Cyclohexanecarboxylic acid
Cyclohexanecarboxylic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
98-89-5 |
| EC NO: |
202-711-3 |
| Molecular Formula: |
C7H12O2 |
| Molecular Weight: |
128.169 |
| Specification: |
99% |
| InChI: |
InChI=1/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9) |
| Packing: |
200kg drum |
| Synonyms: |
Hexahydrobenzoic acid;Cyclohexylcarboxylic Acid; Cyclohexane carboxylic acid
|
| Molecular Structure: |
 |
if you are sourcing Cyclohexanecarboxylic acid from China ,just feel free to inquire
CN
China Suppliers > Shanghai UVTECH > 
Search Product