Details for 5-Nitroanthranilic Acid

5-Nitroanthranilic Acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
616-79-5 |
| EC NO: |
210-493-6 |
| Molecular Formula: |
C7H5N2O4 |
| Molecular Weight: |
181.1261 |
| Specification: |
|
| InChI: |
InChI=1/C7H6N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-3H,8H2,(H,10,11)/p-1 |
| Synonyms: |
Benzoic acid, 2-amino-5-nitro-;2-Amino-5-nitrobenzoic acid;5-Nitroanthranilic acid;NSC 16208;NSC 63867;Anthranilic acid, 5-nitro-;2-amino-5-nitrobenzoate; |
| Molecular Structure: |
 |
if you are sourcing 5-Nitroanthranilic Acid from United-States ,just feel free to inquire