Details for Ethyl Acetate

 
Ethyl Acetate
 
      
        | Category: | 
        Organic chemicals and Derivatives | 
        
        	 | 
      
      
        | CAS NO: | 
      141-78-6   | 
      
      
        | EC NO: | 
        
        205-500-4 | 
      
      
        | Molecular Formula: | 
        
        C4H8O2 | 
      
					
					  | Molecular Weight: | 
                      88.1051 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 | 
                    
                    
                    
                      Product description: 
                      Ethyl acetate CAS: 141-78-6 Formula: C4H8O2 Acetic acid, ethyl ester Acetoxy ethane Acetic ether PubChem: 8857 EC (EINECS/ELINCS): 205-500-4 EC Index Number: 607-022-00-5 RTECS: AH5425000 UN: 1173 Merck: 13,3792 Beilstein/Gmelin: 506104 Beilstein Reference: 4-02-00-00127 RCRA: U112 EPA OPP: 44003  | 
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      Acetic acid ethyl ester;ethyl acetate B&J brand 4 L;ETHYLACETATE ULTRA RESI-ANAL.;ETHYL ACETATE CAPILLARY GRADE;Ethyl Acetate Specially Purified - SPECIFIED;Acetic Ether;RFE;acetic ester;EAC; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Ethyl Acetate from  Germany ,just feel free to inquire