| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5436-21-5 |
| EC NO: |
226-605-1 |
| Molecular Formula: |
C6H12O3 |
| Molecular Weight: |
132.1577 |
| Specification: |
Minimum assay (GC-Wacker): 95.0% |
| InChI: |
InChI=1/C6H12O3/c1-5(7)4-6(8-2)9-3/h6H,4H2,1-3H3 |
| Packing: |
barrel with inner liner (190 kg net) |
Product description:
Synthesis of heterocycles (isoxazoles, pyrazoles, pyrimidines, pyridines etc.)
Intermediate for drugs (e.g. sulfamerazine) and pesticides (herbicides)
|
| Synonyms: |
Acetylacetaldehyde dimethyl acetal;4,4-Dimethoxybutanon;4,4-dimethoxybutan-2-one; |
| Molecular Structure: |
 |