111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
110-13-4 |
EC NO: |
203-738-3 |
Molecular Formula: |
C6H10O2 |
Molecular Weight: |
114.1424 |
Specification: |
Minimum assay (GC-Wacker): 97.0 % |
InChI: |
InChI=1/C6H10O2/c1-5(7)3-4-6(2)8/h3-4H2,1-2H3 |
Packing: |
barrel with inner liner (185 kg net) |
Product description:
For synthesizing heterocycles (2,5-disubstituted thiophenes, furanes, pyrroles and 3,5-subst. isoxazoles)
For synthesis of aroma chemicals and flavours
Intermediate for drugs (e.g. Isocarboxazide, Pyrvinium pamoate, Sulfamethoxazole, Clopirac, Glisoxepid)
|
Synonyms: |
Hexan-2,5-Dion;hexane-2,5-dione;Acetonylacetone; |
Molecular Structure: |
 |