Details for D,L-Serine

D,L-Serine
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
302-84-1 |
| EC NO: |
206-130-6 |
| Molecular Formula: |
C3H7NO3 |
| Molecular Weight: |
105.0926 |
| Specification: |
|
| InChI: |
InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m1/s1 |
Product description:
Odorless, white powder.One of the 20 common amino acids in humans. Non-essential. |
| Synonyms: |
(+/-)-2-Amino-3-hydroxypropionic acid;H-DL-Ser-OH |
| Molecular Structure: |
 |
if you are sourcing D,L-Serine from Germany ,just feel free to inquire