Details for Bisacodyl

Bisacodyl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
603-50-9 |
| EC NO: |
210-044-4 |
| Molecular Formula: |
C22H19NO4 |
| Molecular Weight: |
361.39 |
| Specification: |
|
| InChI: |
InChI=1/C22H19NO4/c1-15(24)26-19-10-6-17(7-11-19)22(21-5-3-4-14-23-21)18-8-12-20(13-9-18)27-16(2)25/h3-14,22H,1-2H3 |
Product description:
An over-the-counter stimulant laxative that can be used in either oral or suppository form. |
| Synonyms: |
alpha-(2-pyridyl)benzhydryl-4,4-diyl di(acetate); |
| Molecular Structure: |
 |
if you are sourcing Bisacodyl from Germany ,just feel free to inquire