Details for Methyl benzoylformate

Methyl benzoylformate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
15206-55-0 |
| EC NO: |
239-263-3 |
| Molecular Formula: |
C9H8O3 |
| Molecular Weight: |
164.158 |
| Specification: |
|
| InChI: |
InChI=1/C9H8O3/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6H,1H3 |
| Synonyms: |
Methyl phenylglyoxylate;Phenylglyoxylic acid methyl ester;IHT-PI MBF;Photoinitiator-MBF;Syna 468;Methyl benzoyl formate;Methyl-α-oxo-phenylacetate;methyl oxo(phenyl)acetate;MBF; |
| Molecular Structure: |
 |
if you are sourcing Methyl benzoylformate from Germany ,just feel free to inquire