Details for Methyl benzoylformate

 
Methyl benzoylformate
 
      
        | Category: | 
        Pharmaceuticals and Biochemicals | 
        
        	 | 
      
      
        | CAS NO: | 
      15206-55-0   | 
      
      
        | EC NO: | 
        
        239-263-3 | 
      
      
        | Molecular Formula: | 
        
        C9H8O3 | 
      
					
					  | Molecular Weight: | 
                      164.158 | 
					
                    
                      | Specification: | 
                      	 | 
                    
                    
                      | InChI: | 
                      InChI=1/C9H8O3/c1-12-9(11)8(10)7-5-3-2-4-6-7/h2-6H,1H3 | 
                    
                    
                    
                    
                    
                    
                      | Synonyms: | 
                      
                      Methyl phenylglyoxylate;Phenylglyoxylic acid methyl ester;IHT-PI MBF;Photoinitiator-MBF;Syna 468;Methyl benzoyl formate;Methyl-α-oxo-phenylacetate;methyl oxo(phenyl)acetate;MBF; | 
                    
					
                      | Molecular Structure: | 
                      
                        | 
                    
                  
 
 
 
 
if you are sourcing  Methyl benzoylformate from  Germany ,just feel free to inquire