Details for Fast Red B Base

Fast Red B Base
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
97-52-9 |
| EC NO: |
202-588-6 |
| Molecular Formula: |
C7H8N2O3 |
| Molecular Weight: |
168.15 |
| Specification: |
|
| InChI: |
InChI=1/C7H8N2O3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,8H2,1H3 |
| Synonyms: |
C.I. 37125;C.I. Azoic Diazo Component 5;Benzenamine, 2-methoxy-4-nitro-;Fast Red Base B;C.I.Azoic Diazo Component 5;2-Methoxy-4-nitroaniline;4-Nitro-o-anisidine;diabaseredb;Diazo fast red b;diazofastredb;Fast red 5na base;Fast Red B-T Base;fastred5nabase;Hiltonil Fast Red B base;hiltonilfastredbbase;Fast Red B base;Red base B;4-Nitro-o-anisidine(NH2=1); |
| Molecular Structure: |
 |
if you are sourcing Fast Red B Base from India ,just feel free to inquire