Details for PARA NITRO ANILINE

PARA NITRO ANILINE
| Category: |
Intermediates/Dyestuff intermediates |
|
| CAS NO: |
100-01-6 |
| EC NO: |
202-810-1 |
| Molecular Formula: |
C6H6N2O2 |
| Molecular Weight: |
138.124 |
| Specification: |
|
| InChI: |
InChI=1/C6H6N2O2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H,7H2 |
| Synonyms: |
C.I. 37035;C.I. Azoic Diazo Component 37;C.I. Developer 17;p-Nitroaniline;fast red GG base;Para Nitro Aniline;Paranitroaniline;Azoic Diazo Component 37;1-Amino-4-nitrobenzene;4-nitroaniline hydrochloride (1:1);mercury bis[(4-nitrophenyl)azanide];4-Nitroaniline(NH2=1); |
| Molecular Structure: |
 |
if you are sourcing PARA NITRO ANILINE from India ,just feel free to inquire