Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
6046-93-1 |
EC NO: |
205-553-3 |
Molecular Formula: |
C2H5CuO3 |
Molecular Weight: |
140.6048 |
Specification: |
|
InChI: |
InChI=1/C2H4O2.Cu.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2/q;+2;/p-1 |
Product description:
;Dark-green crystals;Used as fungicide and in green pigments, chemical synthesis.; |
Synonyms: |
Copper acetate;77408;Pigment Green 20;Verdigris [KP];Acetic acid, copper(2+) salt, monohydrate;cupric acetate monohydrate;Copperacetatemonohydrate;Acetic acid copper(II) salt monohydrate;COPPER ACETATE monohydrate;Copper(Ⅱ)acetate monohydrate;copper(2+) acetate hydrate (1:2:1);acetate, copper(2+) salt, hydrate (1:1:1); |
Molecular Structure: |
 |