| InChI: |
InChI=1/C26H28ClNO.C6H8O7/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-18H,3-4,19-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b26-25+; |
| Synonyms: |
clomiphene citrate;CLOMEPHENE CITRATE;Clomifene Citrate;2-(4-[2-Chloro-1,2-diphenylethenyl]phenoxy)-N,N-diethylethanamine citrate;2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethylethanamine 2-hydroxypropane-1,2,3-tricarboxylate (1:1);2-{4-[(Z)-2-chloro-1,2-diphenylethenyl]phenoxy}-N,N-diethylethanamine 2-hydroxypropane-1,2,3-tricarboxylate (salt);2-{4-[(E)-2-chloro-1,2-diphenylethenyl]phenoxy}-N,N-diethylethanamine 2-hydroxypropane-1,2,3-tricarboxylate (salt); |