| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
5146-66-7 |
| EC NO: |
225-918-0 |
| Molecular Formula: |
C10H15N |
| Molecular Weight: |
149.2328 |
| Specification: |
|
| InChI: |
InChI=1/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6H2,1-3H3/b10-7+ |
Product description:
Clear yellow liquid. Bitter-almond odor.When heated, vapors may form explosive mixtures with air: indoors, outdoors, and sewers explosion hazards. |
| Synonyms: |
1-cyano-2,6-dimethylhepta-1,5-diene;Geranyl nitrile (cis- and trans mixture);Geranyl Nitrite;Citral Nitrile;3,7-dimethylocta-2,6-dienenitrile;(2E)-3,7-dimethylocta-2,6-dienenitrile;3,7-Dimethyl-2,6-Octadienenitrile; |
| Molecular Structure: |
 |