Details for Para Methoxy acetophenone

Para Methoxy acetophenone
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
70-70-2 |
| EC NO: |
200-743-2 |
| Molecular Formula: |
C9H10O2 |
| Molecular Weight: |
150.1745 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O2/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 |
| Synonyms: |
Paroxypropione;p-Methylbenzoic Acid Methyl Ether;P-Hydroxypropiophenone;P-Hydroxyl propiophenone;P-Methoxyacetophenone;PARA Methoxy acetophenone;VANATONE;1-(4-hydroxyphenyl)-1-propanon;1-(4-Hydroxyphenyl)-1-propanone;(4-Hydroxyphenyl)-1-propanone;1-(4-hydroxyphenyl)propan-1-one;4-Hydroxypropiophenone;4'-Hydroxy propiophenone; |
| Molecular Structure: |
 |
if you are sourcing Para Methoxy acetophenone from India ,just feel free to inquire