Details for 3 PHENYL PROPIONYL CHLORIDE

3 PHENYL PROPIONYL CHLORIDE
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
645-45-4 |
| EC NO: |
211-443-6 |
| Molecular Formula: |
C9H9ClO |
| Molecular Weight: |
168.6202 |
| Specification: |
|
| InChI: |
InChI=1/C9H9ClO/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| Synonyms: |
phenylpropionyl chloride;beta-Phenylpropanoyl chloride;3-phenylpropionyl chloride;2-ethoxybenzyl chloride;3-Phenylpropanoyl chlovide; |
| Molecular Structure: |
 |
if you are sourcing 3 PHENYL PROPIONYL CHLORIDE from India ,just feel free to inquire