Details for 1,3-Difluoro Benzene

1,3-Difluoro Benzene
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
372-18-9 |
EC NO: |
206-746-5 |
Molecular Formula: |
C6H4F2 |
Molecular Weight: |
114.0928 |
Specification: |
|
InChI: |
InChI=1/C6H4F2/c7-5-2-1-3-6(8)4-5/h1-4H |
Product description:
Clear light yellow to light brown liquid. |
Synonyms: |
m-Difluorobenzene;m-Difluro Benzene;Aspartic acid beta-monoamide;1,3-Difluoro Benzene; |
Molecular Structure: |
 |
if you are sourcing 1,3-Difluoro Benzene from India ,just feel free to inquire