Details for methyl ester

methyl ester
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
76575-71-8 |
EC NO: |
|
Molecular Formula: |
C7H9NO2S |
Molecular Weight: |
171.2169 |
Specification: |
|
InChI: |
InChI=1/C7H9NO2S/c1-4-3-5(8)6(11-4)7(9)10-2/h3H,8H2,1-2H3 |
Synonyms: |
2-Thiophenecarboxylic acid, 3-amino-5-methyl-, methyl ester;3-Amino-5-methyl-thiophene-2-carboxylic acid; methyl ester;3-Amino-5-methyl-thiophene-2-carboxylic acid methyl ester;3-AMINO-5-METHYLTHIOPHENE-2-CARBOXYLIC ACID,MET. ESTER; |
Molecular Structure: |
 |
if you are sourcing methyl ester from India ,just feel free to inquire