Details for 2,4 Dihydroxy Benzophenone

2,4 Dihydroxy Benzophenone
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
131-56-6 |
| EC NO: |
205-029-4 |
| Molecular Formula: |
C13H10O3 |
| Molecular Weight: |
214.2167 |
| Specification: |
|
| InChI: |
InChI=1/C13H10O3/c14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9/h1-8,14-15H |
| Synonyms: |
Benzoresorcinol;4-benzoylresorcinol;BP-1;UV-0;Benzophenone-1;Ultraviolet absorber UV-0;2,4-Dihydroxy Benzophenone;Ultraviolet absorbent UV-0;2,4-Dihydroxybenzophenone(Benzophenone-1);(2,4-dihydroxyphenyl)phenyl-methanone;Resbenzophenone;FENTAUNIV 0; |
| Molecular Structure: |
 |
if you are sourcing 2,4 Dihydroxy Benzophenone from India ,just feel free to inquire