Details for 4-Methoxy Benzyl Cyanide

4-Methoxy Benzyl Cyanide
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
104-47-2 |
| EC NO: |
203-206-0 |
| Molecular Formula: |
C9H9NO |
| Molecular Weight: |
147.1739 |
| Specification: |
|
| InChI: |
InChI=1/C9H9NO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6H2,1H3 |
| Synonyms: |
p-Anisyl cyanide;p-Methoxybenzyl cyanide;Benzeneacetonitrile, 4-methoxy-;4-Methoxyphenylacetonitrile;4-Methoxybenzyl cyanide;(4-Methoxyphenyl)acetonitrile;Para Methoxy Phenyl Acetonitrile;PMPAcn;4-MPAN; |
| Molecular Structure: |
 |
if you are sourcing 4-Methoxy Benzyl Cyanide from India ,just feel free to inquire