Details for Para-Aminobenzophenone

Para-Aminobenzophenone
| Category: |
Intermediates |
|
| CAS NO: |
1137-41-3 |
| EC NO: |
214-506-6 |
| Molecular Formula: |
C13H11NO |
| Molecular Weight: |
197.2325 |
| Specification: |
|
| InChI: |
InChI=1/C13H11NO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H,14H2 |
| Packing: |
The substance is packed in Fibre Drums. 25 Kg./50 Kg. |
Product description:
Yellow needle crystal
|
| Synonyms: |
4-Amino benzophenone
;Methanone, (4-aminophenyl)phenyl-
;4-14-00-00248 (Beilstein Handbook Reference)
;4-Aminobenzophenone
;AI3-03267;BRN 0389292;NSC 7665;USAF A-233
;p-Aminobenzophenone;p-Benzoylaniline
;Benzophenone, 4-amino-
;(4-aminophenyl)(phenyl)methanone; |
| Molecular Structure: |
 |
if you are sourcing Para-Aminobenzophenone from India ,just feel free to inquire