| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
142-88-1 |
| EC NO: |
205-569-0 |
| Molecular Formula: |
C10H20N2O4 |
| Molecular Weight: |
232.2768 |
| Specification: |
|
| InChI: |
InChI=1/C6H10O4.C4H10N2/c7-5(8)3-1-2-4-6(9)10;1-2-6-4-3-5-1/h1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| Packing: |
10gm. Pouch and 450gm. Tin. |
Product description:
Chemical splash goggles in compliance with OSHA regulations are advised; however, OSHA regulations also permit other type safety glasses. Whre chemical resistant gloves. To prevent repeated or prolonged skin contact, wear impervious clothing and boots.
|
| Synonyms: |
adiprazine;dietelmin;entacyl;hexanedioicacid,compd.withpiperazine(1:1);nometan;oxurasin;oxypaat;oxyzin(tabl.);hexanedioic acid - piperazine (1:1); |
| Molecular Structure: |
 |