Details for 5-Chloro-2-nitrobenzonitrile

5-Chloro-2-nitrobenzonitrile
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
34662-31-2 |
| EC NO: |
252-132-5 |
| Molecular Formula: |
C7H3ClN2O2 |
| Molecular Weight: |
182.5639 |
| Specification: |
|
| InChI: |
InChI=1/C7H3ClN2O2/c8-6-1-2-7(10(11)12)5(3-6)4-9/h1-3H |
Product description:
Causes gastrointestinal irritation with nausea, vomiting and diarrhea. The toxicological properties of this substance have not been fully investigated.
|
| Synonyms: |
2-Nitro-5-chlorobenzonitrile; |
| Molecular Structure: |
 |
if you are sourcing 5-Chloro-2-nitrobenzonitrile from India ,just feel free to inquire