Details for Cetrizine Di HCl

Cetrizine Di HCl
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
83881-52-1 |
| EC NO: |
|
| Molecular Formula: |
C21H27Cl3N2O3 |
| Molecular Weight: |
461.8097 |
| Specification: |
|
| InChI: |
InChI=1/C21H25ClN2O3.2ClH/c22-19-8-6-18(7-9-19)21(17-4-2-1-3-5-17)24-12-10-23(11-13-24)14-15-27-16-20(25)26;;/h1-9,21H,10-16H2,(H,25,26);2*1H |
| Synonyms: |
Cetrizine Di-HCl;Cetirizine Hydrochloride;2-(2-{4-[(4-Chlorophenyl)(phenyl)-methyl]piperazino}ethoxy)acetic acid dihydrochloride;Cetrizine dihydrochloride;(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)acetic acid dihydrochloride;Cetirizine Hcl;Cetirizine dihydrochloride; |
| Molecular Structure: |
 |
if you are sourcing Cetrizine Di HCl from India ,just feel free to inquire