Details for Diazepam Tablets

Diazepam Tablets
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
439-14-5 |
| EC NO: |
207-122-5 |
| Molecular Formula: |
C16H13ClN2O |
| Molecular Weight: |
284.7402 |
| Specification: |
|
| InChI: |
InChI=1/C16H13ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
Product description:
Off-white to yellow crystalline powder. Practically odorless. Tasteless at first with a bitter aftertaste.
|
| Synonyms: |
diazepam methanol solution;Diazepam;7-chloro-1-methyl-5-phenyl-1H-1,4-benzodiazepin-2(3H)-one;7-chloro-1-methyl-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one;Diazapam; |
| Molecular Structure: |
 |
if you are sourcing Diazepam Tablets from India ,just feel free to inquire