Details for 2,5-Dimethoxybenzeldehyde

2,5-Dimethoxybenzeldehyde
Category: |
Intermediates |
|
CAS NO: |
93-02-7 |
EC NO: |
202-211-5 |
Molecular Formula: |
C9H10O3 |
Molecular Weight: |
166.18 |
Specification: |
|
InChI: |
InChI=1/C9H10O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-6H,1-2H3 |
Product description:
Light yellow to yellow with an aldehyde-like odor.Avoid runoff into storm sewers and ditches which lead to waterways. Clean up spills immediately, using the appropriate protective equipment. Remove all sources of ignition. Absorb spill using an absorbent, non-combustible material such as earth, sand, or vermiculite. Provide ventilation. |
Synonyms: |
2,5-Dimethylbenzaldehyde;2,5-Dimethoxy benzaldehyde; |
Molecular Structure: |
 |
if you are sourcing 2,5-Dimethoxybenzeldehyde from Israel ,just feel free to inquire