Details for 4-Methoxyphenylacetone

4-Methoxyphenylacetone
| Category: |
Intermediates |
|
| CAS NO: |
122-84-9 |
| EC NO: |
204-578-7 |
| Molecular Formula: |
C10H12O2 |
| Molecular Weight: |
164.2011 |
| Specification: |
|
| InChI: |
InChI=1/C10H12O2/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6H,7H2,1-2H3 |
Product description:
Light yellow - yellow liquid. Aromatic odor.Eyes: Wear appropriate protective eyeglasses or chemical safety goggles as described by OSHA's eye and face protection regulations in 29 CFR 1910.133 or European Standard EN166. Skin: Wear appropriate protective gloves to prevent skin exposure. Clothing: Wear appropriate protective clothing to prevent skin exposure. |
| Synonyms: |
4-Methoxybenzyl methyl ketone;1-(4-Methoxyphenyl)-2-propanone;P-methoxy phenylacetone;FEMA 2674;4-ANISYL ACETONE;4-(p-methoxyphenyl)butan-2-one;4-ACETONYLANISOLE;1-(P-METHOXYPHENYL)-2-PROPANONE;3-(4-METHOXYPHENYL)-2-PROPANONE;P-METHOXYBENZYL METHYL KETONE;(P-METHOXYPHENYL)ACETONE;P-ANISYL ACETONE;raspberry ketone methyl ether;1-(4-methoxyphenyl)-2-propanon;1-(4-Methoxyphenyl)acetone;1-(Para-methoxyphenyl)-2-propanone;1-(p-methoxyphenyl)-2-propanon;2-Propanone, 1-(p-methoxyphenyl)-;4-Methoxyphenoxyacetone;Anisic ketone;Anisicketone;1-(4-methoxyphenyl)propan-2-one;Para Methoxy Phenyl Acetone;4-Methoxyl benzyl methyl ketone; |
| Molecular Structure: |
 |
if you are sourcing 4-Methoxyphenylacetone from Israel ,just feel free to inquire