Details for 2-Bromobenzyl bromide

2-Bromobenzyl bromide
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
3433-80-5 |
| EC NO: |
222-334-8 |
| Molecular Formula: |
C7H6Br2 |
| Molecular Weight: |
249.9305 |
| Specification: |
|
| InChI: |
InChI=1/C7H6Br2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| Synonyms: |
alpha,2-Dibromotoluene;o-Dibromotoluene;Benzene 1-bromo-2-(bromomethyl);1-bromo-4-(bromomethyl)benzene;1-bromo-2-(bromomethyl)benzene;1-bromo-2-(bromomethyl)-benzen; |
| Molecular Structure: |
 |
if you are sourcing 2-Bromobenzyl bromide from Israel ,just feel free to inquire