Details for L-Serine Methyl Ester Hydrochloride

L-Serine Methyl Ester Hydrochloride
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5680-80-8 |
| EC NO: |
227-140-7 |
| Molecular Formula: |
C4H10NO3 |
| Molecular Weight: |
120.1266 |
| Specification: |
|
| InChI: |
InChI=1/C4H9NO3/c1-8-4(7)3(5)2-6/h3,6H,2,5H2,1H3/p+1/t3-/m0/s1 |
| Synonyms: |
L-Serine Methylester HCl;H-Ser-OMe.HCl;H-Ser-OMe*HCl;methyl L-serinate;(2S)-3-hydroxy-1-methoxy-1-oxopropan-2-aminium;METHYL (2S)-2-AMINO-3-HYDROXYPROPANOATE;H-Ser-OMe·HCl; |
| Molecular Structure: |
 |
if you are sourcing L-Serine Methyl Ester Hydrochloride from Japan ,just feel free to inquire