Details for dinosulfon

dinosulfon
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
5386-77-6 |
| EC NO: |
|
| Molecular Formula: |
C16H22N2O6S |
| Molecular Weight: |
370.4207 |
| Specification: |
|
| InChI: |
InChI=1/C16H22N2O6S/c1-4-5-6-7-8-11(2)13-9-12(17(20)21)10-14(18(22)23)15(13)24-16(19)25-3/h9-11H,4-8H2,1-3H3 |
| Synonyms: |
S-methyl 2-(1-methylheptyl)-4,6-dinitrophenyl thiocarbonate;S-methyl O-[2-(1-methylheptyl)-4,6-dinitrophenyl] thiocarbonate; |
| Molecular Structure: |
 |
if you are sourcing dinosulfon from Japan ,just feel free to inquire