Details for fenothiocarb

fenothiocarb
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
62850-32-2 |
| EC NO: |
|
| Molecular Formula: |
C13H19NO2S |
| Molecular Weight: |
253.3605 |
| Specification: |
|
| InChI: |
InChI=1/C13H19NO2S/c1-14(2)13(15)17-11-7-6-10-16-12-8-4-3-5-9-12/h3-5,8-9H,6-7,10-11H2,1-2H3 |
| Synonyms: |
62850-32-2;Diméthylthiocarbamate de S-(4-phénoxybutyle);S-(4-Phenoxybutyl) dimethylcarbamothioate;S-(4-Phenoxybutyl) dimethylcarbamothioate (9CI);S-(4-Phenoxybutyl)-dimethylthiocarbamat;Fenothiocarb; |
| Molecular Structure: |
 |
if you are sourcing fenothiocarb from Japan ,just feel free to inquire