Details for o-Trifluoromethylbenzoyl chloride

o-Trifluoromethylbenzoyl chloride
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
312-94-7 |
| EC NO: |
206-233-6 |
| Molecular Formula: |
C5H3ClFN |
| Molecular Weight: |
208.57 |
| Specification: |
|
| InChI: |
InChI=1/C5H3ClFN/c6-5-2-1-4(7)3-8-5/h1-3H |
Product description:
A respiratory protection program that meets OSHA's 29 CFR 1910.134 and ANSI Z88.2 requirements or European Standard EN 149 must be followed whenever workplace conditions warrant a respirator's use.
|
| Synonyms: |
2-(Trifluoromethyl)benzoyl chloride;Benzoyl chloride, 2-(trifluoromethyl)-;GVR BXFFF;o-(Trifluoromethyl)benzoyl chloride;2-Trifluoromethyl benzoyl chloride;2-Trifluoromethylbenzoyl chloride;2-(Trifluoromethyl)-Benzoyl Chloride;2-(trifluoromethyl)benzene-1-carbonyl chloride; |
| Molecular Structure: |
 |
if you are sourcing o-Trifluoromethylbenzoyl chloride from Japan ,just feel free to inquire