Details for Cumene hydroperoxide

Cumene hydroperoxide
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
80-15-9 |
| EC NO: |
201-254-7 |
| Molecular Formula: |
C9H14O2 |
| Molecular Weight: |
154.2063 |
| Specification: |
|
| InChI: |
InChI=1/C9H12.H2O2/c1-8(2)9-6-4-3-5-7-9;1-2/h3-8H,1-2H3;1-2H |
| Synonyms: |
Cumene hydroperoxide solution;alpha,alpha-Dimethylbenzyl hydroperoxide;Trigonox?K;Cumyl hydroperoxide;2-phenylpropan-2-yl hydroperoxide;hydrogen peroxide - propan-2-ylbenzene (1:1); |
| Molecular Structure: |
 |
if you are sourcing Cumene hydroperoxide from Netherlands ,just feel free to inquire