Details for Decyloleate

Decyloleate
| Category: |
Catalyst and Auxiliary |
|
| CAS NO: |
3687-46-5 |
| EC NO: |
222-981-6 |
| Molecular Formula: |
C28H54O2 |
| Molecular Weight: |
422.7272 |
| Specification: |
|
| InChI: |
InChI=1/C28H54O2/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-26-28(29)30-27-25-23-21-12-10-8-6-4-2/h15-16H,3-14,17-27H2,1-2H3/b16-15- |
| Synonyms: |
Decyl 9-octadecenoate;9-Octadecenoic acid, decyl ester;Decyl oleate;UNII-ZGR06DO97T;9-Octadecenoic acid (9Z)-, decyl ester;9-Octadecenoic acid (Z)-, decyl ester;Oleic acid, decyl ester;decyl (9Z)-octadec-9-enoate; |
| Molecular Structure: |
 |
if you are sourcing Decyloleate from Netherlands ,just feel free to inquire