| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
643-12-9 |
| EC NO: |
211-394-0 |
| Molecular Formula: |
C6H12O6 |
| Molecular Weight: |
180.1559 |
| Specification: |
|
| InChI: |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 |
Product description:
;PHARMACEUTICALS;Food and Feed Additive;Miscellaneous Natural Products;All Inositols;Biochemistry;Inositol;Sugars;Vitamin Related Compounds;Vitamins;Inositols;
|
| Usage: |
Use: It is understood that in the body D-chiro-inositol or a derivative (ref. 1) might act as a secondary messenger in several metabolic processes including blood sugar control. |
| Synonyms: |
1D-chiro-inositol;(1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol; |
| Molecular Structure: |
 |