| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
125-33-7 |
| EC NO: |
204-737-0 |
| Molecular Formula: |
C12H14N2O2 |
| Molecular Weight: |
218.2518 |
| Specification: |
Anticonvulsant. |
| InChI: |
InChI=1/C12H14N2O2/c1-2-12(9-6-4-3-5-7-9)10(15)13-8-14-11(12)16/h3-7H,2,8H2,1H3,(H,13,15)(H,14,16) |
Product description:
Primidone is an anti-convulsant, anti-epileptic agent. The anti-convulsant properties of primidone are partly attributable to primidone itself and partly to its metabolites phenobarbitone and phenylethylmalonamide. The medicine reduces the sensitiv |
| Synonyms: |
Primidone;5-ethyl-5-phenylperhydropyrimidine-4,6-dione;5-ethyl-5-phenyldihydropyrimidine-4,6(1H,5H)-dione; |
| Molecular Structure: |
 |