Details for 4-Hydroxy-3-ethoxybenzaldehyde

4-Hydroxy-3-ethoxybenzaldehyde
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
121-32-4 |
| EC NO: |
204-464-7 |
| Molecular Formula: |
C9H10O3 |
| Molecular Weight: |
166.1739 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3 |
Product description:
Colorless crystals. More intense vanilla odor and taste than vanillin.In perfumery. |
| Synonyms: |
Ethyl vanillin;protocatechualdehyde ethyl ether;Bourbonal;Ethyl protal;Ethyl protocatechualdehyde 3-ethyl ether;3-Ethoxy-4-hydroxy-benzaldehyde; |
| Molecular Structure: |
 |
if you are sourcing 4-Hydroxy-3-ethoxybenzaldehyde from Other-Regions ,just feel free to inquire