Details for BENZOIC ACID

- BENZOIC ACID
- 
      - 
        | Category: | Pharmaceuticals and Biochemicals |  |  - 
        | CAS NO: | 65-85-0 |  - 
        | EC NO: | 200-618-2 |  - 
        | Molecular Formula: | C7H6O2 |  - 
					  | Molecular Weight: | 122.1224 |  - 
                      | Specification: |  |  - 
                      | InChI: | InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |  - 
                      | Synonyms: | Melting point standard benzoic acid;Benzoic-12C7 acid, 13C-depleted;Benzoic acid, USP Grade;4-Carboxypolystyrene;benzoate;Industrial-use benzoic acid; |  - 
                      | Molecular Structure: |  |  
 
 
 
 
if you are sourcing  BENZOIC ACID from  Other-Regions ,just feel free to inquire