Details for 2-ADAMANTANONE

2-ADAMANTANONE
| Category: |
Intermediates |
|
| CAS NO: |
700-58-3 |
| EC NO: |
211-847-2 |
| Molecular Formula: |
C10H14O |
| Molecular Weight: |
150.2176 |
| Specification: |
|
| InChI: |
InChI=1/C10H14O/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
Product description:
Specification:ASSAY (GC) min. 99,0 %
Capacity of production:Tons per month
Application:Raw material for adamantane derivative
Electronic field |
| Synonyms: |
adamantanone;Tricyclo[3.3.1.1(3,7)]decane-2-one;2-Adamantantanone; ;tricyclo[3.3.1.1~3,7~]decan-2-one;2-Adamantane Ketone; |
| Molecular Structure: |
 |
if you are sourcing 2-ADAMANTANONE from Other-Regions ,just feel free to inquire