Details for 1-Methylindole-3-carboxaldehyde

1-Methylindole-3-carboxaldehyde
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
19012-03-4 |
| EC NO: |
242-750-3 |
| Molecular Formula: |
C10H9NO |
| Molecular Weight: |
159.1846 |
| Specification: |
|
| InChI: |
InChI=1/C10H9NO/c1-11-6-8(7-12)9-4-2-3-5-10(9)11/h2-7H,1H3 |
Product description:
Odorless light yellow to orange cryst. Powder and chunks solid |
| Synonyms: |
AI3-51477;1H-Indole-3-carboxaldehyde, 1-methyl-;1-Methylindole-3-Carboxaldehyde; |
| Molecular Structure: |
 |
if you are sourcing 1-Methylindole-3-carboxaldehyde from Other-Regions ,just feel free to inquire