Details for Ethanol

Ethanol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
141-78-6 |
| EC NO: |
205-500-4 |
| Molecular Formula: |
C4H8O2 |
| Molecular Weight: |
88.1051 |
| Specification: |
|
| InChI: |
InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
Product description:
Ethyl acetate CAS: 141-78-6 Formula: C4H8O2 Acetic acid, ethyl ester Acetoxy ethane Acetic ether PubChem: 8857 EC (EINECS/ELINCS): 205-500-4 EC Index Number: 607-022-00-5 RTECS: AH5425000 UN: 1173 Merck: 13,3792 Beilstein/Gmelin: 506104 Beilstein Reference: 4-02-00-00127 RCRA: U112 EPA OPP: 44003 |
| Synonyms: |
Acetic acid ethyl ester;ethyl acetate B&J brand 4 L;ETHYLACETATE ULTRA RESI-ANAL.;ETHYL ACETATE CAPILLARY GRADE;Ethyl Acetate Specially Purified - SPECIFIED;Acetic Ether;RFE;acetic ester;EAC; |
| Molecular Structure: |
 |
if you are sourcing Ethanol from South-Korea ,just feel free to inquire