Details for Allyl cyanoacetate

Allyl cyanoacetate
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
13361-32-5 |
| EC NO: |
236-423-4 |
| Molecular Formula: |
C6H7NO2 |
| Molecular Weight: |
125.1253 |
| Specification: |
|
| InChI: |
InChI=1/C6H7NO2/c1-2-5-9-6(8)3-4-7/h2H,1,3,5H2 |
| Synonyms: |
Cyanoacetic acid allyl ester;ALLYL CYANOACETATE
CYANOACETIC ACID ALLYL ESTER;cyano-aceticaci2-propenylester;cyano-aceticaciallylester;Acetic acid, cyano-, 2-propenyl ester;prop-2-en-1-yl cyanoacetate; |
| Molecular Structure: |
 |
if you are sourcing Allyl cyanoacetate from Switzerland ,just feel free to inquire