Details for 3-Bromoacetophenone

3-Bromoacetophenone
| Category: |
Other Chemicals/Others |
|
| CAS NO: |
2142-63-4 |
| EC NO: |
218-396-0 |
| Molecular Formula: |
C8H7BrO |
| Molecular Weight: |
199.0446 |
| Specification: |
|
| InChI: |
InChI=1/C8H7BrO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| Synonyms: |
1-(3-Bromophenyl)Ethanone;1-Acetyl-3-Bromobenzene;3-Bromoacetophenone;M-Bromoacetophenone;1-(3-Bromophenyl)-Ethanon;3-Bromoacetephenone;Acetophenone, 3'-Bromo-;Ethanone, 1-(3-Bromophenyl)-;M-Bromophenyl Methyl Ketone;Bromoacetophenone-3;3-Bromo- Acetophenone;3-Bromo Acetophenone;3-ACETYLBROMOBENZENE; |
| Molecular Structure: |
 |
if you are sourcing 3-Bromoacetophenone from Switzerland ,just feel free to inquire