| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
15707-24-1 |
| EC NO: |
239-800-1 |
| Molecular Formula: |
C8H12N2 |
| Molecular Weight: |
136.1943 |
| Specification: |
|
| InChI: |
InChI=1/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3 |
Product description:
;Clear slightly yellow liquid. With a stench.;May cause gastrointestinal irritation with nausea, vomiting and diarrhea. The toxicological properties of this substance have not been fully investigated. ; |
| Synonyms: |
2,3-Diethylpyrazin;2,3-Diéthylpyrazine;pyrazine, 2,3-diethyl-;2,3-Diethyl pyrazine; |
| Molecular Structure: |
 |