Details for 2-METHYL-3-FURANTHIOL

2-METHYL-3-FURANTHIOL
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
28588-74-1 |
| EC NO: |
249-094-7 |
| Molecular Formula: |
C5H6OS |
| Molecular Weight: |
114.1655 |
| Specification: |
|
| InChI: |
InChI=1/C5H6OS/c1-4-5(7)2-3-6-4/h2-3,7H,1H3 |
Product description:
;Pale-yellow.;Carbon monoxide, oxides of sulfur, carbon dioxide. ;Stable under normal temperatures and pressures. ; |
| Synonyms: |
2-Methyl-3-mercapto furan;2-Methyl-3-furanthiol; |
| Molecular Structure: |
 |
if you are sourcing 2-METHYL-3-FURANTHIOL from United-Kingdom ,just feel free to inquire