Details for Daidzein

Daidzein
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
486-66-8 |
| EC NO: |
207-635-4 |
| Molecular Formula: |
C15H10O4 |
| Molecular Weight: |
254.2375 |
| Specification: |
|
| InChI: |
InChI=1/C15H10O4/c16-10-6-4-9(5-7-10)11-8-19-13-3-1-2-12(17)14(13)15(11)18/h1-8,16-17H |
Product description:
;Almost white solid.;Used to evaluate time-resolved fluoroimmunoassay for determination of daidzein in plasma (serum).; |
| Synonyms: |
4',7-Dihydroxyisoflavone;7-hydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one;5-hydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one;4,7-Dihydroxyisoflavone; |
| Molecular Structure: |
 |
if you are sourcing Daidzein from United-Kingdom ,just feel free to inquire