Details for Flavone

Flavone
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
525-82-6 |
| EC NO: |
208-383-8 |
| Molecular Formula: |
C15H10O2 |
| Molecular Weight: |
222.2387 |
| Specification: |
|
| InChI: |
InChI=1/C15H10O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-10H |
Product description:
;White crystalline powder.;The parent substance of a number of important yellow pigments.; |
| Synonyms: |
2-Phenyl-4H-1-benzopyran-4-one;2-Phenylchromone;Flavone(2-Phenylchromone);2-phenyl-4H-chromen-4-one; |
| Molecular Structure: |
 |
if you are sourcing Flavone from United-Kingdom ,just feel free to inquire