Details for 1,4-Dibromobenzene

1,4-Dibromobenzene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
106-37-6 |
| EC NO: |
203-390-2 |
| Molecular Formula: |
C6H4Br2 |
| Molecular Weight: |
235.90576 |
| Specification: |
|
| InChI: |
InChI:1S/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H |
Product description:
Colorless crystals, xylene odor.Organic synthesis of dyestuffs & drugs, manufacture of intermediates, fumigant. |
| Synonyms: |
p-Dibromobenzene;Paradibromobenzene; |
| Molecular Structure: |
 |
if you are sourcing 1,4-Dibromobenzene from United-Kingdom ,just feel free to inquire