Details for 4-Bromoanisole

4-Bromoanisole
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
104-92-7 |
| EC NO: |
203-252-1 |
| Molecular Formula: |
C7H7BrO |
| Molecular Weight: |
187.0339 |
| Specification: |
|
| InChI: |
InChI=1/C7H7BrO/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
Product description:
Clear, colorless liquid.Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Synonyms: |
1-Bromo-4-methoxybenzene;p-Bromoanisole;BROMOANISOLE(4-);4-BROMO ANISOL;1-bromo-4-methoxy-benzen;4-Bromomethoxybenzene;4-Methoxy-1-bromobenzene; |
| Molecular Structure: |
 |
if you are sourcing 4-Bromoanisole from United-Kingdom ,just feel free to inquire