Details for Bromoform

Bromoform
Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
75-25-2 |
EC NO: |
200-854-6 |
Molecular Formula: |
CHBr3 |
Molecular Weight: |
252.7306 |
Specification: |
|
InChI: |
InChI=1/CHBr3/c2-1(3)4/h1H |
Product description:
Bromoform CAS: 75-25-2 Formula: CHBr3 Tribromomethane Methenyl tribromide PubChem: 5558 EC (EINECS/ELINCS): 200-854-6 EC Index Number: 602-007-00-X RTECS: PB5600000 UN: 2515 Merck: 13,1404 Beilstein/Gmelin: 1731048 Beilstein Reference: 4-01-00-00082 RCRA: U225 Swiss Giftliste 1: G-1302 USCG CHRIS Code |
Synonyms: |
methenyl tribromide;Methyl Tribromide;tribromomethane; |
Molecular Structure: |
 |
if you are sourcing Bromoform from United-Kingdom ,just feel free to inquire