Details for Phenyltrimethyl ammonium chloride

Phenyltrimethyl ammonium chloride
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
138-24-9 |
| EC NO: |
205-319-0 |
| Molecular Formula: |
C9H14ClN |
| Molecular Weight: |
171.6672 |
| Specification: |
|
| InChI: |
InChI=1/C9H13N.ClH/c1-6-4-5-9(10)8(3)7(6)2;/h4-5H,10H2,1-3H3;1H |
| Synonyms: |
N,N,N-Trimethylanilinium chloride;Trimethylphenylammonium chloride;Phenyl Trimethyl Ammonium Chloride;Phenyl Trimethyl Ammonium Chlride;N,N,N-trimethylanilinium;Trimethyl phenyl ammonium chloride;PTMAC; |
| Molecular Structure: |
 |
if you are sourcing Phenyltrimethyl ammonium chloride from United-Kingdom ,just feel free to inquire