Details for Phenyltrimethyl ammonium chloride

Phenyltrimethyl ammonium chloride
Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
138-24-9 |
EC NO: |
205-319-0 |
Molecular Formula: |
C9H14ClN |
Molecular Weight: |
171.6672 |
Specification: |
|
InChI: |
InChI=1/C9H13N.ClH/c1-6-4-5-9(10)8(3)7(6)2;/h4-5H,10H2,1-3H3;1H |
Synonyms: |
N,N,N-Trimethylanilinium chloride;Trimethylphenylammonium chloride;Phenyl Trimethyl Ammonium Chloride;Phenyl Trimethyl Ammonium Chlride;N,N,N-trimethylanilinium;Trimethyl phenyl ammonium chloride;PTMAC; |
Molecular Structure: |
 |
if you are sourcing Phenyltrimethyl ammonium chloride from United-Kingdom ,just feel free to inquire